CAS 221241-11-8 appears in our catalog under these names: 2,5-Dibromo-3,4-pyridinediamine, 2,5-Dibromopyridine-3,4-diamine 98%, 2,5-Dibromopyridine-3,4-diamine, 98%, 98%, 2,5-Dibromopyridine-3,4-diamine, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100mg, 250mg, 1g, 5g, 10g, 100g.
2,5-dibromopyridine-3,4-diamine (CAS 221241-11-8) is a chemical compound with the molecular formula C5H5Br2N3 and a molecular weight of 266.92 g/mol. IUPAC name: 2,5-dibromopyridine-3,4-diamine. InChIKey: WDTOXRACOCNQRB-UHFFFAOYSA-N.
| Molecular formula | C5H5Br2N3 |
|---|---|
| Molecular weight | 266.92 g/mol |
| IUPAC name | 2,5-dibromopyridine-3,4-diamine |
| InChIKey | WDTOXRACOCNQRB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Br)N)N)Br |
Computed by PubChem (NCBI)