CAS 2213-82-3 appears in our catalog under these names: 2,5-Dichloro-1,3-Dinitro-Benzene, 2,5-Dichloro-1,3-Dinitrobenzene, 2,5-Dichloro-1,3-dinitrobenzene, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 250mg, 100mg, 1g.
2,5-dichloro-1,3-dinitrobenzene (CAS 2213-82-3) is a chemical compound with the molecular formula C6H2Cl2N2O4 and a molecular weight of 236.99 g/mol. IUPAC name: 2,5-dichloro-1,3-dinitrobenzene. InChIKey: AGGUKALRPKAKSM-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O4 |
|---|---|
| Molecular weight | 236.99 g/mol |
| IUPAC name | 2,5-dichloro-1,3-dinitrobenzene |
| InChIKey | AGGUKALRPKAKSM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)