Products 2213365-56-9
CAS 2213365-56-9 is the registry number for PPARα/γ agonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-naphthalen-1-yl-2-(4-phenylphenoxy)propanoic acid (CAS 2213365-56-9) is a chemical compound with the molecular formula C25H20O3 and a molecular weight of 368.4 g/mol. IUPAC name: 3-naphthalen-1-yl-2-(4-phenylphenoxy)propanoic acid. InChIKey: QZISCDIMRVFENI-UHFFFAOYSA-N.
| Molecular formula | C25H20O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3-naphthalen-1-yl-2-(4-phenylphenoxy)propanoic acid |
| InChIKey | QZISCDIMRVFENI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OC(CC3=CC=CC4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
PPAR|A/|A agonist 2, PPARalpha/gamma agonist 2