CAS 2213400-85-0 appears in our catalog under these names: Florfenicol-d3, Florfenicol-d3, >95% (HPLC), Florfenicol–d3, Florfenicol-d3, 99.90%, D3-Florfenicol. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg.
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-2-yl]acetamide (CAS 2213400-85-0) is a chemical compound with the molecular formula C12H14Cl2FNO4S and a molecular weight of 361.2 g/mol. IUPAC name: 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-2-yl]acetamide. InChIKey: AYIRNRDRBQJXIF-BFHKXKNSSA-N.
| Molecular formula | C12H14Cl2FNO4S |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | 2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-2-yl]acetamide |
| InChIKey | AYIRNRDRBQJXIF-BFHKXKNSSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)