CAS 2214214-03-4 appears in our catalog under these names: Sulpiride EP Impurity F, Sulpiride EP Impurity F (Sulpiride N-Oxide), Sulpiride N-oxide, >95% (HPLC), 1-Ethyl-2-(((2-methoxy-5-sulphamoylbenzoyl)amino)methyl)pyrrolidine 1-Oxide (Sulpiride N-Oxide). Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 1g, 2,5g, 250mg, 100mg.
N-[(1-ethyl-1-oxidopyrrolidin-1-ium-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide (CAS 2214214-03-4) is a chemical compound with the molecular formula C15H23N3O5S and a molecular weight of 357.4 g/mol. IUPAC name: N-[(1-ethyl-1-oxidopyrrolidin-1-ium-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide. InChIKey: GODSKNGSDVZJGQ-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O5S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-[(1-ethyl-1-oxidopyrrolidin-1-ium-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide |
| InChIKey | GODSKNGSDVZJGQ-UHFFFAOYSA-N |
| SMILES | CC[N+]1(CCCC1CNC(=O)C2=C(C=CC(=C2)S(=O)(=O)N)OC)[O-] |
Computed by PubChem (NCBI)