CAS 2215102-00-2 is the registry number for Potassium trifluoro(pivaloyl)borate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2,2-dimethylpropanoyl(trifluoro)boranuide (CAS 2215102-00-2) is a chemical compound with the molecular formula C5H9BF3KO and a molecular weight of 192.03 g/mol. IUPAC name: potassium 2,2-dimethylpropanoyl(trifluoro)boranuide. InChIKey: BPIAEZRHLFCVEK-UHFFFAOYSA-N.
| Molecular formula | C5H9BF3KO |
|---|---|
| Molecular weight | 192.03 g/mol |
| IUPAC name | potassium 2,2-dimethylpropanoyl(trifluoro)boranuide |
| InChIKey | BPIAEZRHLFCVEK-UHFFFAOYSA-N |
| SMILES | [B-](C(=O)C(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)