CAS 221530-44-5 appears in our catalog under these names: Ramelteon Impurity 17, (1,2,6,7,-Tetrahydro-8H-indeno(5,4-b)furan-8-ylidene)acetonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
(2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile (CAS 221530-44-5) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile. InChIKey: TUFWVKLKUFXARX-BJMVGYQFSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (2E)-2-(1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile |
| InChIKey | TUFWVKLKUFXARX-BJMVGYQFSA-N |
| SMILES | C1C/C(=C\C#N)/C2=C1C=CC3=C2CCO3 |
Computed by PubChem (NCBI)