CAS 221552-92-7 is the registry number for Methyl 2-deoxy-3,5-di-O-benzoyl-2-fluoro-4-thio-D-arabinopentofuranoside. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate (CAS 221552-92-7) is a chemical compound with the molecular formula C20H19FO5S and a molecular weight of 390.4 g/mol. IUPAC name: [(2R,3S,4S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate. InChIKey: WUBPGNSEZZQBOT-IWRZSDRUSA-N.
| Molecular formula | C20H19FO5S |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | [(2R,3S,4S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate |
| InChIKey | WUBPGNSEZZQBOT-IWRZSDRUSA-N |
| SMILES | COC1[C@H]([C@@H]([C@H](S1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)