Products 2216744-48-6
CAS 2216744-48-6 is the registry number for 4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine (CAS 2216744-48-6) is a chemical compound with the molecular formula C14H20BN3O2 and a molecular weight of 273.14 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine. InChIKey: JYQVHGVGCSVKJQ-UHFFFAOYSA-N.
| Molecular formula | C14H20BN3O2 |
|---|---|
| Molecular weight | 273.14 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine |
| InChIKey | JYQVHGVGCSVKJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C3=C(C=C2)NN=C3N)C |
Computed by PubChem (NCBI)