CAS 2216744-61-3 is the registry number for 1-(4-Bromo-3-methyl-benzenesulfonyl)-3,3-difluoro-pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-bromo-3-methylphenyl)sulfonyl-3,3-difluoropyrrolidine (CAS 2216744-61-3) is a chemical compound with the molecular formula C11H12BrF2NO2S and a molecular weight of 340.19 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)sulfonyl-3,3-difluoropyrrolidine. InChIKey: KNAPDJLVOQERAC-UHFFFAOYSA-N.
| Molecular formula | C11H12BrF2NO2S |
|---|---|
| Molecular weight | 340.19 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)sulfonyl-3,3-difluoropyrrolidine |
| InChIKey | KNAPDJLVOQERAC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)N2CCC(C2)(F)F)Br |
Computed by PubChem (NCBI)