Products 221681-24-9
CAS 221681-24-9 is the registry number for trans-2,cis-6-Nonadienal-D2. Offered by: TRC. Available pack sizes: 10mg.
(2E,6Z)-6,7-dideuterionona-2,6-dienal (CAS 221681-24-9) is a chemical compound with the molecular formula C9H14O and a molecular weight of 140.22 g/mol. IUPAC name: (2E,6Z)-6,7-dideuterionona-2,6-dienal. InChIKey: HZYHMHHBBBSGHB-YYNJGWFDSA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 140.22 g/mol |
| IUPAC name | (2E,6Z)-6,7-dideuterionona-2,6-dienal |
| InChIKey | HZYHMHHBBBSGHB-YYNJGWFDSA-N |
| SMILES | [2H]/C(=C(\[2H])/CC/C=C/C=O)/CC |
Computed by PubChem (NCBI)