CAS 2217-82-5 is the registry number for Sodium [1,1'-biphenyl]-4-sulfonate 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Sodium 4-phenylbenzenesulfonate (CAS 2217-82-5) is a chemical compound with the molecular formula C12H9NaO3S and a molecular weight of 256.25 g/mol. IUPAC name: sodium 4-phenylbenzenesulfonate. InChIKey: HZHAYUNJXPYUHH-UHFFFAOYSA-M.
| Molecular formula | C12H9NaO3S |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | sodium 4-phenylbenzenesulfonate |
| InChIKey | HZHAYUNJXPYUHH-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)