Products 2218046-01-4
CAS 2218046-01-4 is the registry number for PPARγ agonist 16. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 2218046-01-4) is a chemical compound with the molecular formula C19H14BrNO4S and a molecular weight of 432.3 g/mol. IUPAC name: (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: HRABQKKXQOITAA-LICLKQGHSA-N.
| Molecular formula | C19H14BrNO4S |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | (5E)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | HRABQKKXQOITAA-LICLKQGHSA-N |
| SMILES | COC1=CC=CC=C1/C=C/2\C(=O)N(C(=O)S2)CC(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
PPAR|A agonist 16