CAS 2218519-27-6 is the registry number for 4,4'-((5-(4-(4H-1,2,4-Triazol-4-yl)phenoxy)-1,3-phenylene)bis(oxy))dibenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-(4-carboxyphenoxy)-5-[4-(1,2,4-triazol-4-yl)phenoxy]phenoxy]benzoic acid (CAS 2218519-27-6) is a chemical compound with the molecular formula C28H19N3O7 and a molecular weight of 509.5 g/mol. IUPAC name: 4-[3-(4-carboxyphenoxy)-5-[4-(1,2,4-triazol-4-yl)phenoxy]phenoxy]benzoic acid. InChIKey: CUQKRCRLIOYFOI-UHFFFAOYSA-N.
| Molecular formula | C28H19N3O7 |
|---|---|
| Molecular weight | 509.5 g/mol |
| IUPAC name | 4-[3-(4-carboxyphenoxy)-5-[4-(1,2,4-triazol-4-yl)phenoxy]phenoxy]benzoic acid |
| InChIKey | CUQKRCRLIOYFOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC(=CC(=C2)OC3=CC=C(C=C3)N4C=NN=C4)OC5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)