CAS 22189-91-9 appears in our catalog under these names: 4-(Trifluoromethyl)bicyclo(2.2.2)octan-1-amine hydrochloride, 4-(trifluoromethyl)bicyclo[2.2.2]octan-1-amine hydrochloride, 95%, 95%, 4-(trifluoromethyl)bicyclo[2.2.2]octan-1-amine hydrochloride, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-(trifluoromethyl)bicyclo[2.2.2]octan-1-amine;hydrochloride (CAS 22189-91-9) is a chemical compound with the molecular formula C9H15ClF3N and a molecular weight of 229.67 g/mol. IUPAC name: 4-(trifluoromethyl)bicyclo[2.2.2]octan-1-amine;hydrochloride. InChIKey: PTPQDAKVIDFFEU-UHFFFAOYSA-N.
| Molecular formula | C9H15ClF3N |
|---|---|
| Molecular weight | 229.67 g/mol |
| IUPAC name | 4-(trifluoromethyl)bicyclo[2.2.2]octan-1-amine;hydrochloride |
| InChIKey | PTPQDAKVIDFFEU-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CC2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)