CAS 22190-12-1 is the registry number for 2-(Phenylthio)quinoline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylsulfanylquinoline (CAS 22190-12-1) is a chemical compound with the molecular formula C15H11NS and a molecular weight of 237.32 g/mol. IUPAC name: 2-phenylsulfanylquinoline. InChIKey: BCOSVBKPHCKEII-UHFFFAOYSA-N.
| Molecular formula | C15H11NS |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 2-phenylsulfanylquinoline |
| InChIKey | BCOSVBKPHCKEII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=NC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)