CAS 2219353-62-3 is the registry number for 2-((2R,4S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-fluoropyrrolidin-2-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-[(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidin-2-yl]acetic acid (CAS 2219353-62-3) is a chemical compound with the molecular formula C21H20FNO4 and a molecular weight of 369.4 g/mol. IUPAC name: 2-[(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidin-2-yl]acetic acid. InChIKey: AEARWYJCPQCILX-KBPBESRZSA-N.
| Molecular formula | C21H20FNO4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-[(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropyrrolidin-2-yl]acetic acid |
| InChIKey | AEARWYJCPQCILX-KBPBESRZSA-N |
| SMILES | C1[C@@H](CN([C@@H]1CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)F |
Computed by PubChem (NCBI)