Products 719301-50-5
CAS 719301-50-5 is the registry number for Methyl 2-[[(3-fluoro-3′-methoxy[1,1′-biphenyl]-4-yl)amino]carbonyl]-1-cyclopentene-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylate (CAS 719301-50-5) is a chemical compound with the molecular formula C21H20FNO4 and a molecular weight of 369.4 g/mol. IUPAC name: methyl 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylate. InChIKey: LAWDZLPLHRRPSV-UHFFFAOYSA-N.
| Molecular formula | C21H20FNO4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | methyl 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylate |
| InChIKey | LAWDZLPLHRRPSV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C=C2)NC(=O)C3=C(CCC3)C(=O)OC)F |
Computed by PubChem (NCBI)
Synonyms:
Vidofludimus ethyl ester