CAS 2219353-67-8 is the registry number for (2S,4S)-4-Fluoro-2-(methanesulfonylmethyl)pyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,4S)-4-fluoro-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride (CAS 2219353-67-8) is a chemical compound with the molecular formula C6H13ClFNO2S and a molecular weight of 217.69 g/mol. IUPAC name: (2S,4S)-4-fluoro-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride. InChIKey: BOABCVIRHRNHSC-GEMLJDPKSA-N.
| Molecular formula | C6H13ClFNO2S |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (2S,4S)-4-fluoro-2-(methylsulfonylmethyl)pyrrolidine;hydrochloride |
| InChIKey | BOABCVIRHRNHSC-GEMLJDPKSA-N |
| SMILES | CS(=O)(=O)C[C@@H]1C[C@@H](CN1)F.Cl |
Computed by PubChem (NCBI)