CAS 2219368-43-9 appears in our catalog under these names: 7-Chlorobenzo(d)(1,3)dioxol-5-amine, 98%, 7-Chloro-1,3-benzodioxol-5-amine, 98%, 98%, 7-Chloro-1,3-benzodioxol-5-amine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg.
7-chloro-1,3-benzodioxol-5-amine (CAS 2219368-43-9) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 7-chloro-1,3-benzodioxol-5-amine. InChIKey: AFJFDTGFIUIAHS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 7-chloro-1,3-benzodioxol-5-amine |
| InChIKey | AFJFDTGFIUIAHS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)N)Cl |
Computed by PubChem (NCBI)