Products 2219371-57-8
CAS 2219371-57-8 is the registry number for 1,3,3-Trimethyl-2-oxabicyclo(2.1.1)hexane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2219371-57-8) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: ZZQFZKCXTROSRE-UHFFFAOYSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| InChIKey | ZZQFZKCXTROSRE-UHFFFAOYSA-N |
| SMILES | CC1(C2(CC(C2)(O1)C)C(=O)O)C |
Computed by PubChem (NCBI)