Products 2219372-12-8
CAS 2219372-12-8 is the registry number for rac-(1R,5S)-5-Methyl-6-azabicyclo(3.2.1)octane hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5S)-5-methyl-6-azabicyclo[3.2.1]octane;hydrochloride (CAS 2219372-12-8) is a chemical compound with the molecular formula C8H16ClN and a molecular weight of 161.67 g/mol. IUPAC name: (1R,5S)-5-methyl-6-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: FZIMOFFKGCINLT-WLYNEOFISA-N.
| Molecular formula | C8H16ClN |
|---|---|
| Molecular weight | 161.67 g/mol |
| IUPAC name | (1R,5S)-5-methyl-6-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | FZIMOFFKGCINLT-WLYNEOFISA-N |
| SMILES | C[C@]12CCC[C@H](C1)CN2.Cl |
Computed by PubChem (NCBI)