CAS 2219375-52-5 is the registry number for 2-(Chloromethyl)-6,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(chloromethyl)-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole;hydrochloride (CAS 2219375-52-5) is a chemical compound with the molecular formula C10H15Cl2NS and a molecular weight of 252.20 g/mol. IUPAC name: 2-(chloromethyl)-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole;hydrochloride. InChIKey: YKLKEFUPQHOSGJ-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2NS |
|---|---|
| Molecular weight | 252.20 g/mol |
| IUPAC name | 2-(chloromethyl)-6,6-dimethyl-5,7-dihydro-4H-1,3-benzothiazole;hydrochloride |
| InChIKey | YKLKEFUPQHOSGJ-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)SC(=N2)CCl)C.Cl |
Computed by PubChem (NCBI)