Products 2219375-97-8
CAS 2219375-97-8 is the registry number for rac-(3aR,7aS)-2-Methyl-octahydro-1H-isoindol-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aS,7aR)-2-methyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one;hydrochloride (CAS 2219375-97-8) is a chemical compound with the molecular formula C9H16ClNO and a molecular weight of 189.68 g/mol. IUPAC name: (3aS,7aR)-2-methyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one;hydrochloride. InChIKey: GLSPPXOTZGMTEG-KZYPOYLOSA-N.
| Molecular formula | C9H16ClNO |
|---|---|
| Molecular weight | 189.68 g/mol |
| IUPAC name | (3aS,7aR)-2-methyl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-one;hydrochloride |
| InChIKey | GLSPPXOTZGMTEG-KZYPOYLOSA-N |
| SMILES | CN1C[C@@H]2CCCC(=O)[C@@H]2C1.Cl |
Computed by PubChem (NCBI)