CAS 2219408-23-6 is the registry number for 3-Amino-2-chloro-4,5-difluorobenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride (CAS 2219408-23-6) is a chemical compound with the molecular formula C7H5Cl2F2NO2 and a molecular weight of 244.02 g/mol. IUPAC name: 3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride. InChIKey: RMXLYGLCBXNZLF-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F2NO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride |
| InChIKey | RMXLYGLCBXNZLF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)N)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)