Products 2219408-23-6

CAS 2219408-23-6 is the registry number for 3-Amino-2-chloro-4,5-difluorobenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride (CAS 2219408-23-6) is a chemical compound with the molecular formula C7H5Cl2F2NO2 and a molecular weight of 244.02 g/mol. IUPAC name: 3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride. InChIKey: RMXLYGLCBXNZLF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2F2NO2
Molecular weight244.02 g/mol
IUPAC name3-amino-2-chloro-4,5-difluorobenzoic acid;hydrochloride
InChIKeyRMXLYGLCBXNZLF-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1F)F)N)Cl)C(=O)O.Cl

Computed by PubChem (NCBI)