CAS 2219408-85-0 is the registry number for Lithium 4-chloroquinoline-3-carboxylate, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 50g.
Lithium 4-chloroquinoline-3-carboxylate (CAS 2219408-85-0) is a chemical compound with the molecular formula C10H5ClLiNO2 and a molecular weight of 213.6 g/mol. IUPAC name: lithium 4-chloroquinoline-3-carboxylate. InChIKey: XCVKUNITTDDHPY-UHFFFAOYSA-M.
| Molecular formula | C10H5ClLiNO2 |
|---|---|
| Molecular weight | 213.6 g/mol |
| IUPAC name | lithium 4-chloroquinoline-3-carboxylate |
| InChIKey | XCVKUNITTDDHPY-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=C2C(=C1)C(=C(C=N2)C(=O)[O-])Cl |
Computed by PubChem (NCBI)