CAS 2220111-38-4 is the registry number for (2E)-4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-4-methylpent-2-enedioic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-2-enedioic acid (CAS 2220111-38-4) is a chemical compound with the molecular formula C21H19NO6 and a molecular weight of 381.4 g/mol. IUPAC name: (E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-2-enedioic acid. InChIKey: MEKHPLYYKJFFNI-ZHACJKMWSA-N.
| Molecular formula | C21H19NO6 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (E)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-2-enedioic acid |
| InChIKey | MEKHPLYYKJFFNI-ZHACJKMWSA-N |
| SMILES | CC(/C=C/C(=O)O)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)