CAS 222036-66-0 appears in our catalog under these names: 5–aminoisoindolin–1–one, 5-Aminoisoindolin-1-one, 5-Aminoisoindolin-1-one 98%, 1H-Isoindol-1-one, 5-amino-2,3-dihydro-, 98%, 98%, 5-Amino-2,3-dihydro-1H-isoindol-1-one, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
5-amino-2,3-dihydroisoindol-1-one (CAS 222036-66-0) is a chemical compound with the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. IUPAC name: 5-amino-2,3-dihydroisoindol-1-one. InChIKey: RGJCJWXNNDARPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | 5-amino-2,3-dihydroisoindol-1-one |
| InChIKey | RGJCJWXNNDARPQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C(=O)N1 |
Computed by PubChem (NCBI)