CAS 22206-57-1 appears in our catalog under these names: Tetrabutylammonium Fluoride Hydrate, >95% (HPLC), Tetrabutylammonium fluoride hydrate, Tetrabutylammonium Fluoride Hydrate [for Catalyst of silylation and cleavage of silyl ether], >98.0%(T), Tetrabutylammonium fluoride xhydrate 85%, TETRABUTYLAMMONIUM FLUORIDE HYDRATE, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 50g, 5g, 500g, 25g, 100g, 10G.
Tetrabutylazanium;fluoride;hydrate (CAS 22206-57-1) is a chemical compound with the molecular formula C16H38FNO and a molecular weight of 279.48 g/mol. IUPAC name: tetrabutylazanium;fluoride;hydrate. InChIKey: UQCWXKSHRQJGPH-UHFFFAOYSA-M.
| Molecular formula | C16H38FNO |
|---|---|
| Molecular weight | 279.48 g/mol |
| IUPAC name | tetrabutylazanium;fluoride;hydrate |
| InChIKey | UQCWXKSHRQJGPH-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O.[F-] |
Computed by PubChem (NCBI)