CAS 222191-15-3 is the registry number for Fenoprofen Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-2-(3-phenoxyphenyl)propanoic acid (CAS 222191-15-3) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-methyl-2-(3-phenoxyphenyl)propanoic acid. InChIKey: ITWDGOLFVXYKNJ-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-methyl-2-(3-phenoxyphenyl)propanoic acid |
| InChIKey | ITWDGOLFVXYKNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)