CAS 2221939-76-8 is the registry number for Cholamine Bromide Hydrobromide-15N. Offered by: TRC. Available pack sizes: 250mg.
2-(15N)azanylethyl(trimethyl)azanium;bromide;hydrobromide (CAS 2221939-76-8) is a chemical compound with the molecular formula C5H16Br2N2 and a molecular weight of 265.00 g/mol. IUPAC name: 2-(15N)azanylethyl(trimethyl)azanium;bromide;hydrobromide. InChIKey: NXHOZHHNVARBSS-SNHBFGBXSA-M.
| Molecular formula | C5H16Br2N2 |
|---|---|
| Molecular weight | 265.00 g/mol |
| IUPAC name | 2-(15N)azanylethyl(trimethyl)azanium;bromide;hydrobromide |
| InChIKey | NXHOZHHNVARBSS-SNHBFGBXSA-M |
| SMILES | C[N+](C)(C)CC[15NH2].Br.[Br-] |
Computed by PubChem (NCBI)