CAS 2221948-74-7 is the registry number for (2,5-Dibromo-3,6-difluoro-1,4-phenylene)bis(trimethylsilane), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dibromo-3,6-difluoro-4-trimethylsilylphenyl)-trimethylsilane (CAS 2221948-74-7) is a chemical compound with the molecular formula C12H18Br2F2Si2 and a molecular weight of 416.25 g/mol. IUPAC name: (2,5-dibromo-3,6-difluoro-4-trimethylsilylphenyl)-trimethylsilane. InChIKey: IRPRMKBSYQRRQA-UHFFFAOYSA-N.
| Molecular formula | C12H18Br2F2Si2 |
|---|---|
| Molecular weight | 416.25 g/mol |
| IUPAC name | (2,5-dibromo-3,6-difluoro-4-trimethylsilylphenyl)-trimethylsilane |
| InChIKey | IRPRMKBSYQRRQA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C(=C(C(=C1Br)F)[Si](C)(C)C)Br)F |
Computed by PubChem (NCBI)