CAS 2221991-22-4 is the registry number for Potassium trifluoro(2-methoxy-1,3-thiazol-5-yl)boranuide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
Potassium trifluoro-(2-methoxy-1,3-thiazol-5-yl)boranuide (CAS 2221991-22-4) is a chemical compound with the molecular formula C4H4BF3KNOS and a molecular weight of 221.06 g/mol. IUPAC name: potassium trifluoro-(2-methoxy-1,3-thiazol-5-yl)boranuide. InChIKey: KWSRIZYMCPXFBJ-UHFFFAOYSA-N.
| Molecular formula | C4H4BF3KNOS |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | potassium trifluoro-(2-methoxy-1,3-thiazol-5-yl)boranuide |
| InChIKey | KWSRIZYMCPXFBJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CN=C(S1)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)