CAS 2222117-40-8 is the registry number for E3 Ligase Ligand-linker Conjugate 221. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,6-dioxopiperidin-3-yl)-3-piperazin-1-ylpyrrolo[3,4-b]pyrazine-5,7-dione;hydrochloride (CAS 2222117-40-8) is a chemical compound with the molecular formula C15H17ClN6O4 and a molecular weight of 380.78 g/mol. IUPAC name: 6-(2,6-dioxopiperidin-3-yl)-3-piperazin-1-ylpyrrolo[3,4-b]pyrazine-5,7-dione;hydrochloride. InChIKey: WZWGMAURQWSNNV-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN6O4 |
|---|---|
| Molecular weight | 380.78 g/mol |
| IUPAC name | 6-(2,6-dioxopiperidin-3-yl)-3-piperazin-1-ylpyrrolo[3,4-b]pyrazine-5,7-dione;hydrochloride |
| InChIKey | WZWGMAURQWSNNV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=NC=C(N=C3C2=O)N4CCNCC4.Cl |
Computed by PubChem (NCBI)