Products 2222444-69-9
CAS 2222444-69-9 is the registry number for 3-(2-(Aminomethyl)-1H-benzo[d]imidazol-1-yl)propane-1-sulfonic acid dihydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg.
3-[2-(aminomethyl)benzimidazol-1-yl]propane-1-sulfonic acid;dihydrochloride (CAS 2222444-69-9) is a chemical compound with the molecular formula C11H17Cl2N3O3S and a molecular weight of 342.2 g/mol. IUPAC name: 3-[2-(aminomethyl)benzimidazol-1-yl]propane-1-sulfonic acid;dihydrochloride. InChIKey: QRAVPXUQDYMLCP-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O3S |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 3-[2-(aminomethyl)benzimidazol-1-yl]propane-1-sulfonic acid;dihydrochloride |
| InChIKey | QRAVPXUQDYMLCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CCCS(=O)(=O)O)CN.Cl.Cl |
Computed by PubChem (NCBI)