CAS 2222511-78-4 is the registry number for 1-(Benzyloxy)-3-(methoxy-d3)-5-(trifluoromethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-phenylmethoxy-3-(trideuteriomethoxy)-5-(trifluoromethoxy)benzene (CAS 2222511-78-4) is a chemical compound with the molecular formula C15H13F3O3 and a molecular weight of 301.27 g/mol. IUPAC name: 1-phenylmethoxy-3-(trideuteriomethoxy)-5-(trifluoromethoxy)benzene. InChIKey: AXXHCNLEKWTQLP-FIBGUPNXSA-N.
| Molecular formula | C15H13F3O3 |
|---|---|
| Molecular weight | 301.27 g/mol |
| IUPAC name | 1-phenylmethoxy-3-(trideuteriomethoxy)-5-(trifluoromethoxy)benzene |
| InChIKey | AXXHCNLEKWTQLP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)OC(F)(F)F)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)