Products 2222511-84-2

CAS 2222511-84-2 is the registry number for Methyl 2-[(2-aminoethyl)amino]-5-nitrobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(2-aminoethylamino)-5-nitrobenzoate;hydrochloride (CAS 2222511-84-2) is a chemical compound with the molecular formula C10H14ClN3O4 and a molecular weight of 275.69 g/mol. IUPAC name: methyl 2-(2-aminoethylamino)-5-nitrobenzoate;hydrochloride. InChIKey: ZCAWBBXIHITBCM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClN3O4
Molecular weight275.69 g/mol
IUPAC namemethyl 2-(2-aminoethylamino)-5-nitrobenzoate;hydrochloride
InChIKeyZCAWBBXIHITBCM-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])NCCN.Cl

Computed by PubChem (NCBI)