CAS 2222512-13-0 is the registry number for Methyl-d3 (2,2,2-trifluoroethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,2,2-trifluoro-N-(trideuteriomethyl)ethanamine;hydrochloride (CAS 2222512-13-0) is a chemical compound with the molecular formula C3H7ClF3N and a molecular weight of 152.56 g/mol. IUPAC name: 2,2,2-trifluoro-N-(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: CUOWKFXFKFXJEL-NIIDSAIPSA-N.
| Molecular formula | C3H7ClF3N |
|---|---|
| Molecular weight | 152.56 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | CUOWKFXFKFXJEL-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCC(F)(F)F.Cl |
Computed by PubChem (NCBI)