Products 2222565-19-5
CAS 2222565-19-5 is the registry number for Y08060. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-2-methoxy-N-(6-methoxy-2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide (CAS 2222565-19-5) is a chemical compound with the molecular formula C18H19BrN2O6S and a molecular weight of 471.3 g/mol. IUPAC name: 5-bromo-2-methoxy-N-(6-methoxy-2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide. InChIKey: BVPMJOFBUGYDAV-UHFFFAOYSA-N.
| Molecular formula | C18H19BrN2O6S |
|---|---|
| Molecular weight | 471.3 g/mol |
| IUPAC name | 5-bromo-2-methoxy-N-(6-methoxy-2,2-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)benzenesulfonamide |
| InChIKey | BVPMJOFBUGYDAV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=CC(=C(C=C2O1)NS(=O)(=O)C3=C(C=CC(=C3)Br)OC)OC)C |
Computed by PubChem (NCBI)
Synonyms:
orb1987156, EFM