Products 2222660-40-2
CAS 2222660-40-2 is the registry number for DNDI-8219. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6R)-2-nitro-6-[4-(trifluoromethoxy)phenoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (CAS 2222660-40-2) is a chemical compound with the molecular formula C13H10F3N3O5 and a molecular weight of 345.23 g/mol. IUPAC name: (6R)-2-nitro-6-[4-(trifluoromethoxy)phenoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine. InChIKey: IXUWKDINJWESQG-SNVBAGLBSA-N.
| Molecular formula | C13H10F3N3O5 |
|---|---|
| Molecular weight | 345.23 g/mol |
| IUPAC name | (6R)-2-nitro-6-[4-(trifluoromethoxy)phenoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| InChIKey | IXUWKDINJWESQG-SNVBAGLBSA-N |
| SMILES | C1[C@H](COC2=NC(=CN21)[N+](=O)[O-])OC3=CC=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)