CAS 2222742-96-1 is the registry number for (S)-4-Bromo-5-fluoro-2-((1,1,1-trifluoropropan-2-yl)oxy)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzonitrile (CAS 2222742-96-1) is a chemical compound with the molecular formula C10H6BrF4NO and a molecular weight of 312.06 g/mol. IUPAC name: 4-bromo-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzonitrile. InChIKey: HSVRDXDMKLKJMP-YFKPBYRVSA-N.
| Molecular formula | C10H6BrF4NO |
|---|---|
| Molecular weight | 312.06 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzonitrile |
| InChIKey | HSVRDXDMKLKJMP-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(F)(F)F)OC1=CC(=C(C=C1C#N)F)Br |
Computed by PubChem (NCBI)