CAS 2222768-84-3 appears in our catalog under these names: 4-(4-Diethylaminophenyl)-2-(2,4-difluoro-phenylamino)-thiazole-5-carboxylic acid ethyl ester, 95%, Dynarrestin/ 99.49% (existing batch purity), Dynarrestin, Dynarrestin 99%, Dynarrestin, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 5mg, 50mg, 2mg, 25mg, 100mg, 250mg, 1mg.
Ethyl 4-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)-1,3-thiazole-5-carboxylate (CAS 2222768-84-3) is a chemical compound with the molecular formula C22H23F2N3O2S and a molecular weight of 431.5 g/mol. IUPAC name: ethyl 4-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)-1,3-thiazole-5-carboxylate. InChIKey: UZNNDDDSGCMQOQ-UHFFFAOYSA-N.
| Molecular formula | C22H23F2N3O2S |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | ethyl 4-[4-(diethylamino)phenyl]-2-(2,4-difluoroanilino)-1,3-thiazole-5-carboxylate |
| InChIKey | UZNNDDDSGCMQOQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=C(SC(=N2)NC3=C(C=C(C=C3)F)F)C(=O)OCC |
Computed by PubChem (NCBI)