Products 2222822-23-1
CAS 2222822-23-1 is the registry number for Kv7 activator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[1-cyclobutyl-4-fluoro-6-(2-hydroxypropan-2-yl)benzimidazol-2-yl]-3,3-dimethylbutanamide (CAS 2222822-23-1) is a chemical compound with the molecular formula C20H28FN3O2 and a molecular weight of 361.5 g/mol. IUPAC name: N-[1-cyclobutyl-4-fluoro-6-(2-hydroxypropan-2-yl)benzimidazol-2-yl]-3,3-dimethylbutanamide. InChIKey: WDWHPPWJGSSWSB-UHFFFAOYSA-N.
| Molecular formula | C20H28FN3O2 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | N-[1-cyclobutyl-4-fluoro-6-(2-hydroxypropan-2-yl)benzimidazol-2-yl]-3,3-dimethylbutanamide |
| InChIKey | WDWHPPWJGSSWSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=NC2=C(N1C3CCC3)C=C(C=C2F)C(C)(C)O |
Computed by PubChem (NCBI)