CAS 1801338-27-1 is the registry number for 5-Fluoro adbica. Offered by: Biosynth. Available pack sizes: 25mg, 50mg.
N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)indole-3-carboxamide (CAS 1801338-27-1) is a chemical compound with the molecular formula C20H28FN3O2 and a molecular weight of 361.5 g/mol. IUPAC name: N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)indole-3-carboxamide. InChIKey: ITZSOCZDFSHNCL-QGZVFWFLSA-N.
| Molecular formula | C20H28FN3O2 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)indole-3-carboxamide |
| InChIKey | ITZSOCZDFSHNCL-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N)NC(=O)C1=CN(C2=CC=CC=C21)CCCCCF |
Computed by PubChem (NCBI)