Products 2222930-72-3
CAS 2222930-72-3 is the registry number for Anticancer agent 31. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(4-phenoxyphenyl)urea (CAS 2222930-72-3) is a chemical compound with the molecular formula C28H21F2N5O2 and a molecular weight of 497.5 g/mol. IUPAC name: 1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(4-phenoxyphenyl)urea. InChIKey: STADTCXKZRQMEY-UHFFFAOYSA-N.
| Molecular formula | C28H21F2N5O2 |
|---|---|
| Molecular weight | 497.5 g/mol |
| IUPAC name | 1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(4-phenoxyphenyl)urea |
| InChIKey | STADTCXKZRQMEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC=CC(=C3)CNC4=NC5=CC(=C(C=C5N=C4)F)F |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 31, orb1686677