Products 2222930-76-7
CAS 2222930-76-7 is the registry number for Anticancer agent 32. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(3,5-dimethylphenyl)urea (CAS 2222930-76-7) is a chemical compound with the molecular formula C24H21F2N5O and a molecular weight of 433.5 g/mol. IUPAC name: 1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(3,5-dimethylphenyl)urea. InChIKey: QKMYYEFHARJZOA-UHFFFAOYSA-N.
| Molecular formula | C24H21F2N5O |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 1-[3-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]phenyl]-3-(3,5-dimethylphenyl)urea |
| InChIKey | QKMYYEFHARJZOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)NC2=CC=CC(=C2)CNC3=NC4=CC(=C(C=C4N=C3)F)F)C |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 32, orb1687617