CAS 2222959-56-8 is the registry number for 2-(Methylthio)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-methylsulfanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2222959-56-8) is a chemical compound with the molecular formula C13H20BNO2S and a molecular weight of 265.2 g/mol. IUPAC name: 2-methylsulfanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: KDMYJXVILNWJLT-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2S |
|---|---|
| Molecular weight | 265.2 g/mol |
| IUPAC name | 2-methylsulfanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | KDMYJXVILNWJLT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)SC |
Computed by PubChem (NCBI)