CAS 2223005-65-8 is the registry number for 2–(4–(1,4–dioxan–2–yl)furan–2–yl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-[4-(1,4-dioxan-2-yl)furan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223005-65-8) is a chemical compound with the molecular formula C14H21BO5 and a molecular weight of 280.13 g/mol. IUPAC name: 2-[4-(1,4-dioxan-2-yl)furan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VZOWLFAJEAMXNQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BO5 |
|---|---|
| Molecular weight | 280.13 g/mol |
| IUPAC name | 2-[4-(1,4-dioxan-2-yl)furan-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VZOWLFAJEAMXNQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)C3COCCO3 |
Computed by PubChem (NCBI)