CAS 2223009-03-6 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine (CAS 2223009-03-6) is a chemical compound with the molecular formula C10H20BNO2 and a molecular weight of 197.08 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine. InChIKey: JYEJFUIULVBNAN-UHFFFAOYSA-N.
| Molecular formula | C10H20BNO2 |
|---|---|
| Molecular weight | 197.08 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine |
| InChIKey | JYEJFUIULVBNAN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCNC2 |
Computed by PubChem (NCBI)