Products 2223009-16-1
CAS 2223009-16-1 is the registry number for 4，4，5，5–tetramethyl–2–(5–(tetrahydrofuran–2–yl)furan–2–yl)–1，3，2–dioxaborolane. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
4,4,5,5-tetramethyl-2-[5-(oxolan-2-yl)furan-2-yl]-1,3,2-dioxaborolane (CAS 2223009-16-1) is a chemical compound with the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-(oxolan-2-yl)furan-2-yl]-1,3,2-dioxaborolane. InChIKey: SEMQSAPIFJJCMP-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-(oxolan-2-yl)furan-2-yl]-1,3,2-dioxaborolane |
| InChIKey | SEMQSAPIFJJCMP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C3CCCO3 |
Computed by PubChem (NCBI)